NSC51696
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-22T14:48:33Z | |
dc.date.available | 2005-08-22T14:48:33Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-22T14:48:33Z | |
dc.identifier | NSC51696 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/50898 | |
dc.format.extent | 2599 bytes | |
dc.format.extent | 3402 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC51696 | en_GB |
dc.title.alternative | 1-(Methylthio)-2-propanol | en_GB |
dc.title.alternative | 2-Propanol, 1-(methylthio)- (8CI9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VHMYGROEIUZTQW-BYPYZUCNSA-N | |
dc.identifier.inchi | InChI=1S/C4H10OS/c1-4(5)3-6-2/h4-5H,3H2,1-2H3/t4-/m0/s1 | |
dc.identifier.ichi | C4H10OS,1H3-4H(5H)3H2-6-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules