NSC3715
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-12T18:12:54Z | |
dc.date.available | 2004-12-12T18:12:54Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-12T18:12:54Z | |
dc.identifier | NSC3715 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/5130 | |
dc.format.extent | 2694 bytes | |
dc.format.extent | 3318 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC3715 | en_GB |
dc.title.alternative | Guanidine, N,N-dimethyl-, sulfate (2:1) (9CI) | en_GB |
dc.title.alternative | Guanidine, 1, 1-dimethyl-, sulfate (2:1) | en_GB |
dc.title.alternative | N(1),N(1)-Dimethylguanidine sulfate (2:1) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | SWSQBOPZIKWTGO-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C3H9N3/c1-6(2)3(4)5/h1-2H3,(H3,4,5) | |
dc.identifier.ichi | C3H9N3,1H3-6(2H3)3(4H)5H2 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules