NSC3803
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-12T18:15:27Z | |
dc.date.available | 2004-12-12T18:15:27Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-12T18:15:27Z | |
dc.identifier | NSC3803 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/5217 | |
dc.format.extent | 2258 bytes | |
dc.format.extent | 3005 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC3803 | en_GB |
dc.title.alternative | Guanidine, methyl-, sulfate (2:1) (8CI9CI) | en_GB |
dc.title.alternative | Methylguanidine sulfate (VAN) | en_GB |
dc.title.alternative | N1-Methylguanidine sulfate (2:1) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | CHJJGSNFBQVOTG-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C2H7N3/c1-5-2(3)4/h1H3,(H4,3,4,5) | |
dc.identifier.ichi | C2H7N3,1H3-5H-2(3H)4H2 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules