NSC56377
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T09:46:21Z | |
dc.date.available | 2005-08-23T09:46:21Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T09:46:21Z | |
dc.identifier | NSC56377 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/54081 | |
dc.format.extent | 3173 bytes | |
dc.format.extent | 3881 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC56377 | en_GB |
dc.title.alternative | .beta.-Dimethylaminoisopropyl chloride, hydrochloride | en_GB |
dc.title.alternative | (.beta.-Chloroisopropyl)dimethylamine-hydrochloride | en_GB |
dc.title.alternative | Ethylamine, 2-chloro-N,N,1-trimethyl-, hydrochloride | en_GB |
dc.title.alternative | 2-Propanamine, 1-chloro-N,N-dimethyl-, hydrochloride (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ZMLUHYJUTIZTOJ-RXMQYKEDSA-N | |
dc.identifier.inchi | InChI=1S/C5H12ClN/c1-5(4-6)7(2)3/h5H,4H2,1-3H3/t5-/m1/s1 | |
dc.identifier.ichi | C5H12ClN,1H3-5H(4H2-6)7(2H3)3H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules