NSC57047
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T10:23:52Z | |
dc.date.available | 2005-08-23T10:23:52Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T10:23:52Z | |
dc.identifier | NSC57047 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/54607 | |
dc.format.extent | 2567 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC57047 | en_GB |
dc.title.alternative | L-Cysteine, reaction product with formaldehyde and sodium hydroxymethanesulfinate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | XUJNEKJLAYXESH-REOHCLBHSA-N | |
dc.identifier.inchi | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 | |
dc.identifier.ichi | C3H7NO2S,4H2-3H(1H2-7H)2(5)6H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules