NSC60174
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T12:37:53Z | |
dc.date.available | 2005-08-23T12:37:53Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T12:37:53Z | |
dc.identifier | NSC60174 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/56819 | |
dc.format.extent | 12415 bytes | |
dc.format.extent | 9975 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC60174 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | HVFCKNMMWXWNFZ-UDKJZCLYSA-N | |
dc.identifier.inchi | InChI=1S/C28H50N4O2S/c1-5-7-9-11-13-15-17-19-21-23-29-31-27(33)25(3)35-26(4)28(34)32-30-24-22-20-18-16-14-12-10-8-6-2/h5-6,23-26H,1-2,7-22H2,3-4H3,(H,31,33)(H,32,34)/b29-23-,30-24+/t25-,26+/m1/s1 | |
dc.identifier.ichi | C28H50N4O2S,1H2-5H-9H2-13H2-17H2-21H2-23H2-19H2-15H2-11H2-7H-29-31H-25(33)27H(3H3)35-28H(4H3)26(34)32H-30-8H-12H2-16H2-20H2-24H2-22H2-18H2-14H2-10H2-6H-2H2 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules