NSC60338
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2005-08-23T12:45:54Z | |
| dc.date.available | 2005-08-23T12:45:54Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2005-08-23T12:45:54Z | |
| dc.identifier | NSC60338 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/56980 | |
| dc.format.extent | 4421 bytes | |
| dc.format.extent | 4473 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC60338 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | VFJGSRBYEZCSMQ-RXMQYKEDSA-N | |
| dc.identifier.inchi | InChI=1S/C7H15N3O3/c8-3-4-10-6(11)2-1-5(9)7(12)13/h5H,1-4,8-9H2,(H,10,11)(H,12,13)/t5-/m1/s1 | |
| dc.identifier.ichi | C7H15N3O3,8H2-3H2-4H2-10H-5(11)1H2-2H2-7H(9H2)6(12)13H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules