NSC60535
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2005-08-23T12:56:43Z | |
| dc.date.available | 2005-08-23T12:56:43Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2005-08-23T12:56:43Z | |
| dc.identifier | NSC60535 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57169 | |
| dc.format.extent | 2290 bytes | |
| dc.format.extent | 3129 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC60535 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | JFMGYULNQJPJCY-GSVOUGTGSA-N | |
| dc.identifier.inchi | InChI=1S/C4H6O4/c5-1-3-2-7-4(6)8-3/h3,5H,1-2H2/t3-/m1/s1 | |
| dc.identifier.ichi | C4H6O4,5-3-7-2H2-4H(1H2-6H)8-3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules