NSC4323
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T11:08:36Z | |
dc.date.available | 2004-12-13T11:08:36Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T11:08:36Z | |
dc.identifier | NSC4323 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/5717 | |
dc.format.extent | 4580 bytes | |
dc.format.extent | 4573 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC4323 | en_GB |
dc.title.alternative | Caffeic acid dimethyl ether | en_GB |
dc.title.alternative | Cinnamic acid, 3,4-dimethoxy- (8CI) | en_GB |
dc.title.alternative | 2-Propenoic acid, 3-(3,4-dimethoxyphenyl)- (9CI) | en_GB |
dc.title.alternative | 3, 4-Dimethoxycinnamic acid | en_GB |
dc.title.alternative | 3,4-Dimethoxyphenyl-2-propenoic acid | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | HJBWJAPEBGSQPR-GQCTYLIASA-N | |
dc.identifier.inchi | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ | |
dc.identifier.ichi | C11H12O4,1H3-14-9-5H-3H-8(4H-6H-11(12)13H)7H-10(9)15-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules