NSC60554
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T12:57:53Z | |
dc.date.available | 2005-08-23T12:57:53Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T12:57:53Z | |
dc.identifier | NSC60554 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57188 | |
dc.format.extent | 2930 bytes | |
dc.format.extent | 3485 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC60554 | en_GB |
dc.title.alternative | 2-Pyrazolin-5-one, 3,4-dimethyl- (8CI) | en_GB |
dc.title.alternative | 3,4-Dimethyl-5-pyrazolone | en_GB |
dc.title.alternative | 3H-Pyrazol-3-one, 2,4-dihydro-4,5-dimethyl- (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | PRCIXKQBKWRGMA-VKHMYHEASA-N | |
dc.identifier.inchi | InChI=1S/C5H8N2O/c1-3-4(2)6-7-5(3)8/h3H,1-2H3,(H,7,8)/t3-/m0/s1 | |
dc.identifier.ichi | C5H8N2O,1H3-3-5H(2H3)4(8)7H-6-3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules