NSC4326
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T11:08:38Z | |
dc.date.available | 2004-12-13T11:08:38Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T11:08:38Z | |
dc.identifier | NSC4326 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/5719 | |
dc.format.extent | 3164 bytes | |
dc.format.extent | 3841 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC4326 | en_GB |
dc.title.alternative | .alpha.-Ethynylbenzyl alcohol | en_GB |
dc.title.alternative | .alpha.-Phenylpropargyl alcohol | en_GB |
dc.title.alternative | Benzenemethanol, .alpha.-ethynyl- (9CI) | en_GB |
dc.title.alternative | Benzyl alcohol, .alpha.-ethynyl- (8CI) | en_GB |
dc.title.alternative | Phenylethynylcarbinol | en_GB |
dc.title.alternative | 1-Phenylpropargyl alcohol | en_GB |
dc.title.alternative | 2-Propyn-1-ol, 1-phenyl- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | UIGLAZDLBZDVBL-SECBINFHSA-N | |
dc.identifier.inchi | InChI=1S/C9H8O/c1-2-9(10)8-6-4-3-5-7-8/h1,3-7,9-10H/t9-/m1/s1 | |
dc.identifier.ichi | C9H8O,1H-2-9H(10H)8-6H-4H-3H-5H-7H-8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules