NSC60648
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T13:03:49Z | |
dc.date.available | 2005-08-23T13:03:49Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T13:03:49Z | |
dc.identifier | NSC60648 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57282 | |
dc.format.extent | 2200 bytes | |
dc.format.extent | 3071 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC60648 | en_GB |
dc.title.alternative | Phenol, 3,4-dichloro- (8CI9CI) | en_GB |
dc.title.alternative | 3,4-Dichlorophenol | en_GB |
dc.title.alternative | 4, 5-Dichlorophenol | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | WDNBURPWRNALGP-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C6H4Cl2O/c7-5-2-1-4(9)3-6(5)8/h1-3,9H | |
dc.identifier.ichi | C6H4Cl2O,7-5-2H-1H-4(9H)3H-6(5)8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules