NSC61000
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T13:24:02Z | |
dc.date.available | 2005-08-23T13:24:02Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T13:24:02Z | |
dc.identifier | NSC61000 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57562 | |
dc.format.extent | 2352 bytes | |
dc.format.extent | 3139 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC61000 | en_GB |
dc.title.alternative | Carbamic acid, thio-, O-ethyl ester (8CI) | en_GB |
dc.title.alternative | Carbamothioic acid, O-ethyl ester (9CI) | en_GB |
dc.title.alternative | Ethyl thionocarbamate | en_GB |
dc.title.alternative | O-Ethyl thiocarbamate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | PWZUZQNZVZKCBI-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C3H7NOS/c1-2-5-3(4)6/h2H2,1H3,(H2,4,6) | |
dc.identifier.ichi | C3H7NOS,1H3-2H2-5-3(4H2)6 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules