NSC61716
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T13:36:28Z | |
dc.date.available | 2005-08-23T13:36:28Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T13:36:28Z | |
dc.identifier | NSC61716 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57837 | |
dc.format.extent | 11016 bytes | |
dc.format.extent | 9222 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC61716 | en_GB |
dc.title.alternative | Searle 35 | en_GB |
dc.title.alternative | 11H-Indeno[2,1-a]phenanthrene-9,10-dicarboxylic anhydride, 1,2,3,4,4a,4b,5,6,6a,8,9,10,10a,11a,11b, 12-hexadecahydro-2,7-dihydroxy-4a,6a-dimethyl-, diacetate | en_GB |
dc.title.alternative | 16, 17-(1',2'-cyclohex-2'-eno)androst-5-ene-5',6'-dicarboxylic anhydride diacetate | en_GB |
dc.title.alternative | 16,17-(1', 2'-Cyclohex-2'-eno)androst-5-ene-5',6'-dicarboxylic anhydride, 3.beta.,3'-dihydroxy-, diacetate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | SPDGZKJSOWGZIE-WHACFCQTSA-N | |
dc.identifier.inchi | InChI=1S/C29H36O7/c1-14(30)34-17-7-9-28(3)16(11-17)5-6-18-21(28)8-10-29(4)22(18)12-19-24-20(26(32)36-27(24)33)13-23(25(19)29)35-15(2)31/h5,17-22,24H,6-13H2,1-4H3/t17-,18+,19-,20+,21-,22-,24+,28-,29-/m0/s1 | |
dc.identifier.ichi | C29H36O7,1H3-14(30)34-17-12H2-22H-19(32)35-20(33)27H(22)23H-13H2-26H-24H-6H2-5H-16-11H2-21H(36-15(2H3)31)7H2-9H2-28(16,3H3)25H(24)8H2-10H2-29(26,4H3)18(17)23 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules