NSC62590
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T14:48:24Z | |
dc.date.available | 2005-08-23T14:48:24Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T14:48:24Z | |
dc.identifier | NSC62590 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/58393 | |
dc.format.extent | 5606 bytes | |
dc.format.extent | 5276 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC62590 | en_GB |
dc.title.alternative | [Dichloroacetaldehyde-8-caffeine]hydrazone | en_GB |
dc.title.alternative | Acetaldehyde, dichloro-, (1,3,7-trimethyl-8-xanthinyl)hydrazone | en_GB |
dc.title.alternative | Acetaldehyde, dichloro-, (2,3,6,7-tetrahydro-1,3,7-trimethyl-2, 6-dioxo-1H-purin-8-yl)hydrazone (9CI) | en_GB |
dc.title.alternative | Caffeine, 8-[2-(2, 2-dichloroethylidene)hydrazino]- | en_GB |
dc.title.alternative | 2,2-Dichloroacetaldehyde (1,3, 7-trimethyl-8-xanthinyl)hydrazone | en_GB |
dc.title.alternative | 8-[2-(2, 2-Dichloroethylidene)hydrazino]caffeine | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | GMXXSOIXMQJOOD-YIXHJXPBSA-N | |
dc.identifier.inchi | InChI=1S/C10H12Cl2N6O2/c1-16-6-7(14-9(16)15-13-4-5(11)12)17(2)10(20)18(3)8(6)19/h4-5H,1-3H3,(H,14,15)/b13-4+ | |
dc.identifier.ichi | C10H12Cl2N6O2,1H3-16-5-6(15H-8(16)14-13-4H-10H(11)12)17(2H3)9(20)18(3H3)7(5)19 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules