NSC63479
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T15:29:02Z | |
dc.date.available | 2005-08-23T15:29:02Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T15:29:02Z | |
dc.identifier | NSC63479 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/58904 | |
dc.format.extent | 4790 bytes | |
dc.format.extent | 4806 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC63479 | en_GB |
dc.title.alternative | Benzoic acid, 2,2-bis(2-chloroethyl)hydrazide (8CI 9CI) | en_GB |
dc.title.alternative | Hydrazine, 2-benzoyl-1,1-bis(2-chloroethyl)- | en_GB |
dc.title.alternative | 2-Benzoyl-1, 1-bis(2-chloroethyl)hydrazine | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | BHABEVYEURFFCY-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C11H14Cl2N2O/c12-6-8-15(9-7-13)14-11(16)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,14,16) | |
dc.identifier.ichi | C11H14Cl2N2O,12-6H2-8H2-15(9H2-7H2-13)14H-11(16)10-4H-2H-1H-3H-5H-10 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules