NSC63826
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T15:32:41Z | |
dc.date.available | 2005-08-23T15:32:41Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T15:32:41Z | |
dc.identifier | NSC63826 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/58972 | |
dc.format.extent | 6737 bytes | |
dc.format.extent | 6140 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC63826 | en_GB |
dc.title.alternative | Codeine, 10-hydroxy- | en_GB |
dc.title.alternative | CODEINE, 10-HYDROXY- | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ZDGQZOCAKDGPRA-QZFGMEPXSA-N | |
dc.identifier.inchi | InChI=1S/C18H21NO4/c1-19-8-7-18-10-4-5-11(20)17(18)23-16-12(22-2)6-3-9(13(16)18)15(21)14(10)19/h3-6,10-11,14-15,17,20-21H,7-8H2,1-2H3/t10-,11-,14-,15-,17-,18-/m1/s1 | |
dc.identifier.ichi | C18H21NO4,1H3-19-8H2-7H2-18-11-9-3H-4H-10(22-2H3)12(11)23-17H(18)14H(20H)6H-5H-13H(18)16H(19)15H(9)21H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules