NSC64356
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T15:54:19Z | |
dc.date.available | 2005-08-23T15:54:19Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T15:54:19Z | |
dc.identifier | NSC64356 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/59192 | |
dc.format.extent | 4002 bytes | |
dc.format.extent | 4229 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC64356 | en_GB |
dc.title.alternative | Propanoic acid, 3-[(4-methylphenyl)thio]- (9CI) | en_GB |
dc.title.alternative | 3-(p-Tolylthio)propionic acid | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ZRYGVBRPRKRFHJ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C10H12O2S/c1-8-2-4-9(5-3-8)13-7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12) | |
dc.identifier.ichi | C10H12O2S,1H3-8-2H-4H-9(5H-3H-8)13-7H2-6H2-10(11)12H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules