NSC65446
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T16:27:22Z | |
dc.date.available | 2005-08-23T16:27:22Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T16:27:22Z | |
dc.identifier | NSC65446 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/59777 | |
dc.format.extent | 2600 bytes | |
dc.format.extent | 3424 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC65446 | en_GB |
dc.title.alternative | Ethyl vinyl carbinol | en_GB |
dc.title.alternative | 1-Penten-3-ol (8CI9CI) | en_GB |
dc.title.alternative | 1-Pentene-3-ol | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VHVMXWZXFBOANQ-YFKPBYRVSA-N | |
dc.identifier.inchi | InChI=1S/C5H10O/c1-3-5(6)4-2/h3,5-6H,1,4H2,2H3/t5-/m0/s1 | |
dc.identifier.ichi | C5H10O,1H2-3H-5H(6H)4H2-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules