NSC66055
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T17:08:24Z | |
dc.date.available | 2005-08-23T17:08:24Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T17:08:24Z | |
dc.identifier | NSC66055 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/60229 | |
dc.format.extent | 5328 bytes | |
dc.format.extent | 4956 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC66055 | en_GB |
dc.title.alternative | 1,2-Propanedione, bis(imidazolidin-2-ylidene hydrazone) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | RLKJLADFFIKRSF-QSPLRUFESA-N | |
dc.identifier.inchi | InChI=1S/C9H16N8/c1-7(15-17-9-12-4-5-13-9)6-14-16-8-10-2-3-11-8/h6H,2-5H2,1H3,(H2,10,11,16)(H2,12,13,17)/b14-6+,15-7- | |
dc.identifier.ichi | C9H16N8,1H3-7(11-13-9-16H-5H2-6H2-17H-9)2H-10-12-8-14H-3H2-4H2-15H-8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules