NSC66742
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T17:39:34Z | |
dc.date.available | 2005-08-23T17:39:34Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T17:39:34Z | |
dc.identifier | NSC66742 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/60794 | |
dc.format.extent | 10723 bytes | |
dc.format.extent | 8660 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC66742 | en_GB |
dc.title.alternative | p-Benzenediacrylanilide, 4',4''-bis(N,N'-dimethylamidino)-, dihydrochloride,hydrate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | TUTOLXLCCKWUFE-LQGKIZFRSA-N | |
dc.identifier.inchi | InChI=1S/C30H32N6O2/c1-31-29(32-2)23-11-15-25(16-12-23)35-27(37)19-9-21-5-7-22(8-6-21)10-20-28(38)36-26-17-13-24(14-18-26)30(33-3)34-4/h5-20H,1-4H3,(H,31,32)(H,33,34)(H,35,37)(H,36,38)/b19-9+,20-10+ | |
dc.identifier.ichi | C30H32N6O2,1H3-31-29(33H-3H3)23-11H-15H-25(16H-12H-23)35H-27(37)19H-9H-21-5H-7H-22(8H-6H-21)10H-20H-28(38)36H-26-17H-13H-24(14H-18H-26)30(32-2H3)34H-4H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules