NSC67027
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T18:14:23Z | |
dc.date.available | 2005-08-23T18:14:23Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T18:14:23Z | |
dc.identifier | NSC67027 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/60917 | |
dc.format.extent | 4139 bytes | |
dc.format.extent | 4285 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC67027 | en_GB |
dc.title.alternative | Levulinic acid, amidinohydrazone, hydrochloride | en_GB |
dc.title.alternative | Pentanoic acid, 4-[(aminoiminomethyl)hydrazono]-, monohydrochloride (9CI) | en_GB |
dc.title.alternative | Valeric acid, 4-amidinohydrazone, hydrochloride | en_GB |
dc.title.alternative | WLN: QV2Y1& UNMYZUM &GH | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | GCTMBYBFFUEVMM-WTKPLQERSA-N | |
dc.identifier.inchi | InChI=1S/C6H12N4O2/c1-4(2-3-5(11)12)9-10-6(7)8/h2-3H2,1H3,(H,11,12)(H4,7,8,10)/b9-4- | |
dc.identifier.ichi | C6H12N4O2,1H3-4(2H2-3H2-5(11)12H)9-10H-6(7H)8H2 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules