NSC4734
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T11:17:44Z | |
dc.date.available | 2004-12-13T11:17:44Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T11:17:44Z | |
dc.identifier | NSC4734 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/6105 | |
dc.format.extent | 2236 bytes | |
dc.format.extent | 3119 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC4734 | en_GB |
dc.title.alternative | Furazan, dimethyl- (8CI9CI) | en_GB |
dc.title.alternative | Furazan, 3,4-dimethyl- | en_GB |
dc.title.alternative | 3, 4-Dimethyl-1,2,5-oxadiazole | en_GB |
dc.title.alternative | 3,4-Dimethylfurazan | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | JKJSZGJVBAWEFB-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C4H6N2O/c1-3-4(2)6-7-5-3/h1-2H3 | |
dc.identifier.ichi | C4H6N2O,1H3-3-4(2H3)6-7-5-3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules