NSC67447
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T18:31:54Z | |
dc.date.available | 2005-08-23T18:31:54Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T18:31:54Z | |
dc.identifier | NSC67447 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/61260 | |
dc.format.extent | 6319 bytes | |
dc.format.extent | 5751 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC67447 | en_GB |
dc.title.alternative | Guanidine, N-[2-(dimethylamino)ethyl]-N',N''-di-2-pyridinyl-, trihydrochloride (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | SGKATVQYHFPZKD-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C15H20N6/c1-21(2)12-11-18-15(19-13-7-3-5-9-16-13)20-14-8-4-6-10-17-14/h3-10H,11-12H2,1-2H3,(H2,16,17,18,19,20) | |
dc.identifier.ichi | C15H20N6,1H3-21(2H3)12H2-11H2-18-15(19H-13-7H-3H-5H-9H-16-13)20H-14-8H-4H-6H-10H-17-14 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules