NSC67456
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T18:32:26Z | |
dc.date.available | 2005-08-23T18:32:26Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T18:32:26Z | |
dc.identifier | NSC67456 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/61269 | |
dc.format.extent | 6040 bytes | |
dc.format.extent | 5584 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC67456 | en_GB |
dc.title.alternative | Carbamimidothioic acid, (3,6-dioxo-2,5-piperazinediyl)di-2, 1-ethanediyl ester, dihydrochloride (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | RONFRKKUMMJVNT-PHDIDXHHSA-N | |
dc.identifier.inchi | InChI=1S/C10H18N6O2S2/c11-9(12)19-3-1-5-7(17)16-6(8(18)15-5)2-4-20-10(13)14/h5-6H,1-4H2,(H3,11,12)(H3,13,14)(H,15,18)(H,16,17)/t5-,6-/m1/s1 | |
dc.identifier.ichi | C10H18N6O2S2,11H-7(13H2)19-3H2-1H2-9H-5(17)16H-10H(6(18)15H-9)2H2-4H2-20-8(12H)14H2 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules