NSC67983
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T18:57:57Z | |
dc.date.available | 2005-08-23T18:57:57Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T18:57:57Z | |
dc.identifier | NSC67983 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/61649 | |
dc.format.extent | 4601 bytes | |
dc.format.extent | 4743 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC67983 | en_GB |
dc.title.alternative | Crotonic acid, hexyl ester (8CI) | en_GB |
dc.title.alternative | Hexyl crotonate | en_GB |
dc.title.alternative | Hexyl 2-butenoate | en_GB |
dc.title.alternative | 2-Butenoic acid, hexyl ester (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | MZNHUHNWGVUEAT-YWEYNIOJSA-N | |
dc.identifier.inchi | InChI=1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h4,8H,3,5-7,9H2,1-2H3/b8-4- | |
dc.identifier.ichi | C10H18O2,1H3-3H-4H-10(11)12-9H2-8H2-7H2-6H2-5H2-2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules