NSC69294
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T20:00:04Z | |
dc.date.available | 2005-08-23T20:00:04Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T20:00:04Z | |
dc.identifier | NSC69294 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/62535 | |
dc.format.extent | 12627 bytes | |
dc.format.extent | 10160 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC69294 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | LSSPIOYZZCPTLA-ANUGHELFSA-N | |
dc.identifier.inchi | InChI=1S/C36H43NO6/c1-20(38)42-24-12-14-35(3)23(16-24)10-11-25-28(35)13-15-36(4)29(25)17-26-31-27(18-30(32(26)36)43-21(2)39)33(40)37(34(31)41)19-22-8-6-5-7-9-22/h5-10,24-29,31H,11-19H2,1-4H3/t24-,25+,26-,27-,28-,29+,31-,35-,36+/m1/s1 | |
dc.identifier.ichi | C36H43NO6,1H3-20(38)42-24-17H2-29H-26(40)37(18H2-22-8H-6H-5H-7H-9H-22)27(41)34H(29)30H-19H2-33H-31H-11H2-10H-23-16H2-28H(43-21(2H3)39)12H2-14H2-35(23,3H3)32H(31)13H2-15H2-36(33,4H3)25(24)30 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules