NSC69396
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T20:02:11Z | |
dc.date.available | 2005-08-23T20:02:11Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T20:02:11Z | |
dc.identifier | NSC69396 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/62575 | |
dc.format.extent | 11844 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC69396 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | AYZBNIKAICJPLV-HBROMCMVSA-N | |
dc.identifier.inchi | InChI=1S/C32H35ClN6O4/c1-34-29(38-13-17-42-18-14-38)22-3-8-25(9-4-22)36-31(40)24-7-12-27(28(33)21-24)32(41)37-26-10-5-23(6-11-26)30(35-2)39-15-19-43-20-16-39/h3-12,21H,13-20H2,1-2H3,(H,36,40)(H,37,41)/b34-29-,35-30+ | |
dc.identifier.ichi | C32H35ClN6O4,1H3-34-29(38-14H2-18H2-42-19H2-15H2-38)22-3H-8H-25(9H-4H-22)36H-31(40)24-7H-12H-27(28(33)13H-24)32(41)37H-26-10H-5H-23(6H-11H-26)30(35-2H3)39-16H2-20H2-43-21H2-17H2-39 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules