NSC69590
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T20:09:45Z | |
dc.date.available | 2005-08-23T20:09:45Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T20:09:45Z | |
dc.identifier | NSC69590 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/62708 | |
dc.format.extent | 8103 bytes | |
dc.format.extent | 7139 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC69590 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | KQHKUOHLCRQQSG-QMOMMWDFSA-N | |
dc.identifier.inchi | InChI=1S/C20H32O3/c1-19-7-5-14(22)10-13(19)3-4-15-16(19)6-8-20(2)17(15)9-12(11-21)18(20)23/h12-17,21-22H,3-11H2,1-2H3/t12-,13-,14-,15+,16-,17-,19-,20-/m0/s1 | |
dc.identifier.ichi | C20H32O3,1H3-19-7H2-6H2-17H-16H(18H(19)9H2-13H(11H2-22H)12(19)21)4H2-3H2-14H-10H2-15H(23H)5H2-8H2-20(14,17)2H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules