NSC71109
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T21:15:50Z | |
dc.date.available | 2005-08-23T21:15:50Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T21:15:50Z | |
dc.identifier | NSC71109 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/63700 | |
dc.format.extent | 2218 bytes | |
dc.format.extent | 3043 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC71109 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | JUVFOWOFPFXHJN-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C5H5IN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 | |
dc.identifier.ichi | C5H5IN2O,1H3-9-5-3H-2H-4(6)7-8-5 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules