NSC72932
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-24T10:00:53Z | |
dc.date.available | 2005-08-24T10:00:53Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-24T10:00:53Z | |
dc.identifier | NSC72932 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/65049 | |
dc.format.extent | 7176 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC72932 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | IUHZUDKJZWNYSH-GKXFERKMSA-O | |
dc.identifier.inchi | InChI=1S/C10H14N2.5CHNS.Co/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;5*2-1-3;/h2,4,6,8,10H,3,5,7H2,1H3;5*3H;/q;;;;;;-10/p+1/t10-;;;;;;/m0....../s1 | |
dc.identifier.ichi | C15H20CoN7S5,1H3-22-13H2-11H2-12H2-15H(22)14-8H-7H-9H-23H(10H-14)16(24H-2-17,25H-3-18,26H-4-19,27H-5-20)28H-6-21 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules