NSC5747
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T12:04:29Z | |
dc.date.available | 2004-12-13T12:04:29Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T12:04:29Z | |
dc.identifier | NSC5747 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7060 | |
dc.format.extent | 3761 bytes | |
dc.format.extent | 4207 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC5747 | en_GB |
dc.title.alternative | Naphthalene-1,8-dicarboxylic acid anhydride | en_GB |
dc.title.alternative | Naphthalic acid anhydride | en_GB |
dc.title.alternative | Naphthalic anhydride | en_GB |
dc.title.alternative | Protect | en_GB |
dc.title.alternative | WLN: T666 1A M CVOVJ | en_GB |
dc.title.alternative | 1, 8-Naphthalenedicarboxylic acid anhydride | en_GB |
dc.title.alternative | 1, 8-Naphthalenedicarboxylic anhydride | en_GB |
dc.title.alternative | 1,8-Naphthalic acid anhydride | en_GB |
dc.title.alternative | 1,8-Naphthalic anhydride | en_GB |
dc.title.alternative | 1H,3H-Naphtho[1,8-cd]pyran-1, 3-dione (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | GRSMWKLPSNHDHA-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H | |
dc.identifier.ichi | C12H6O3,13-11-8-5H-1H-3H-7-4H-2H-6H-9(10(7)8)12(14)15-11 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules