NSC81445
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-25T09:44:08Z | |
dc.date.available | 2005-08-25T09:44:08Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-25T09:44:08Z | |
dc.identifier | NSC81445 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/71110 | |
dc.format.extent | 4861 bytes | |
dc.format.extent | 4711 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC81445 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VIVLFSUDRCCWEF-JXOAFFINSA-N | |
dc.identifier.inchi | InChI=1S/C10H11N3O6/c11-1-4-2-13(10(18)12-8(4)17)9-7(16)6(15)5(3-14)19-9/h2,5-7,9,14-16H,3H2,(H,12,17,18)/t5-,6-,7-,9-/m1/s1 | |
dc.identifier.ichi | C10H11N3O6,11-1-4-2H-13(6(15)12H-5(4)14)10H-9H(18H)8H(17H)7H(3H2-16H)19-10 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules