NSC5919
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T12:09:12Z | |
dc.date.available | 2004-12-13T12:09:12Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T12:09:12Z | |
dc.identifier | NSC5919 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7214 | |
dc.format.extent | 9927 bytes | |
dc.format.extent | 8653 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC5919 | en_GB |
dc.title.alternative | 9-Phenanthrenemethanol, .alpha.-[(diisopentylamino)methyl]-1,2,3, 4-tetrahydro-, hydrochloride | en_GB |
dc.title.alternative | 9-Phenanthrenemethanol, .alpha.-[[bis(4-methylbutyl)amino]methyl]-1,2,3,4-tetrahydro-, hydrochloride (8CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | HURQNHBXXMWZBW-SANMLTNESA-N | |
dc.identifier.inchi | InChI=1S/C26H39NO/c1-19(2)13-15-27(16-14-20(3)4)18-26(28)25-17-21-9-5-6-10-22(21)23-11-7-8-12-24(23)25/h7-8,11-12,17,19-20,26,28H,5-6,9-10,13-16,18H2,1-4H3/t26-/m0/s1 | |
dc.identifier.ichi | C26H39NO,1H3-24H(2H3)14H2-16H2-27(17H2-15H2-25H(3H3)4H3)18H2-26H(28H)22-9H-19-12H2-10H2-11H2-13H2-23(19)21-8H-6H-5H-7H-20(21)22 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules