NSC6113
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T13:28:21Z | |
dc.date.available | 2004-12-13T13:28:21Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T13:28:21Z | |
dc.identifier | NSC6113 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7404 | |
dc.format.extent | 3629 bytes | |
dc.format.extent | 3960 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC6113 | en_GB |
dc.title.alternative | Theophylline, 8-chloro- (8CI) | en_GB |
dc.title.alternative | 1,3-Dimethyl-8-chloroxanthine | en_GB |
dc.title.alternative | 1H-Purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl- (9CI) | en_GB |
dc.title.alternative | 8-Chlorotheophylline | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | RYIGNEOBDRVTHA-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) | |
dc.identifier.ichi | C7H7ClN4O2,1H3-11-4-3(10H-6(8)9-4)5(13)12(2H3)7(11)14 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules