NSC6497
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T13:36:36Z | |
dc.date.available | 2004-12-13T13:36:36Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T13:36:36Z | |
dc.identifier | NSC6497 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7773 | |
dc.format.extent | 2982 bytes | |
dc.format.extent | 3532 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC6497 | en_GB |
dc.title.alternative | Dinicotinic acid | en_GB |
dc.title.alternative | Pyridine-3,5-dicarboxylic acid | en_GB |
dc.title.alternative | 3, 5-Pyridinedicarboxylic acid (8CI9CI) | en_GB |
dc.title.alternative | 5-Carboxynicotinic acid | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | MPFLRYZEEAQMLQ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12) | |
dc.identifier.ichi | C7H5NO4,9-6(11H)4-1H-5(7(10)12H)3H-8-2H-4 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules