NSC6530
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T13:37:28Z | |
dc.date.available | 2004-12-13T13:37:28Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T13:37:28Z | |
dc.identifier | NSC6530 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7804 | |
dc.format.extent | 3341 bytes | |
dc.format.extent | 3960 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC6530 | en_GB |
dc.title.alternative | Formic acid, isopentyl ester | en_GB |
dc.title.alternative | Isoamyl formate | en_GB |
dc.title.alternative | Isoamyl methanoate | en_GB |
dc.title.alternative | Isopentyl alcohol, formate (8CI) | en_GB |
dc.title.alternative | Isopentyl formate | en_GB |
dc.title.alternative | Isopentyl methanoate | en_GB |
dc.title.alternative | WLN: VHO2Y1 & 1 | en_GB |
dc.title.alternative | 1-Butanol, 3-methyl-, formate (9CI) | en_GB |
dc.title.alternative | 3-Methylbutyl formate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | XKYICAQFSCFURC-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C6H12O2/c1-6(2)3-4-8-5-7/h5-6H,3-4H2,1-2H3 | |
dc.identifier.ichi | C6H12O2,1H3-6H(2H3)4H2-5H2-8-3H-7 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules