NSC6737
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T13:43:23Z | |
dc.date.available | 2004-12-13T13:43:23Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T13:43:23Z | |
dc.identifier | NSC6737 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/8008 | |
dc.format.extent | 1860 bytes | |
dc.format.extent | 2909 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC6737 | en_GB |
dc.title.alternative | Propanal, 2,3-dibromo- (9CI) | en_GB |
dc.title.alternative | Propionaldehyde, 2,3-dibromo- | en_GB |
dc.title.alternative | WLN: VHYE1E | en_GB |
dc.title.alternative | 2,3-Dibromopropionaldehyde | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ZMDDOWQHSDJXDW-GSVOUGTGSA-N | |
dc.identifier.inchi | InChI=1S/C3H4Br2O/c4-1-3(5)2-6/h2-3H,1H2/t3-/m1/s1 | |
dc.identifier.ichi | C3H4Br2O,4-2H2-3H(5)1H-6 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules