NSC6797
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T13:45:22Z | |
dc.date.available | 2004-12-13T13:45:22Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T13:45:22Z | |
dc.identifier | NSC6797 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/8068 | |
dc.format.extent | 5132 bytes | |
dc.format.extent | 5061 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC6797 | en_GB |
dc.title.alternative | .beta.-Phenylbenzenepropanoic acid | en_GB |
dc.title.alternative | Benzenepropanoic acid, .beta.-phenyl- (9CI) | en_GB |
dc.title.alternative | Diphenylpropionic acid | en_GB |
dc.title.alternative | Hydrocinnamic acid, .beta.-phenyl- | en_GB |
dc.title.alternative | Propionic acid, 3,3-diphenyl- | en_GB |
dc.title.alternative | 3, 3-Diphenylpropanoic acid | en_GB |
dc.title.alternative | 3,3-Diphenylpropionic acid | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | BZQGAPWJKAYCHR-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C15H14O2/c16-15(17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,17) | |
dc.identifier.ichi | C15H14O2,16-14(17H)11H2-15H(12-7H-3H-1H-4H-8H-12)13-9H-5H-2H-6H-10H-13 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules