NSC7236
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T14:31:20Z | |
dc.date.available | 2004-12-13T14:31:20Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T14:31:20Z | |
dc.identifier | NSC7236 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/8498 | |
dc.format.extent | 3858 bytes | |
dc.format.extent | 4174 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC7236 | en_GB |
dc.title.alternative | o-Ethyl thiocarbanilate | en_GB |
dc.title.alternative | Carbamothioic acid, phenyl-, O-ethyl ester (9CI) | en_GB |
dc.title.alternative | Carbanilic acid, thio-, o-ethyl ester | en_GB |
dc.title.alternative | Carbanilic acid, thiono-, ethyl ester | en_GB |
dc.title.alternative | WLN: SUYO2&MR | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | WXNKKAIEQXMTBZ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C9H11NOS/c1-2-11-9(12)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,12) | |
dc.identifier.ichi | C9H11NOS,1H3-7H2-11-9(12)10H-8-5H-3H-2H-4H-6H-8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules