NSC122209
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2005-09-02T12:56:43Z | |
| dc.date.available | 2005-09-02T12:56:43Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2005-09-02T12:56:43Z | |
| dc.identifier | NSC122209 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/98251 | |
| dc.format.extent | 4653 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC122209 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | XWRSGLHADOYUFN-PFONDFGASA-N | |
| dc.identifier.inchi | InChI=1S/C8H12Cl2N6O/c9-1-3-16(4-2-10)15-14-8-6(7(11)17)12-5-13-8/h5H,1-4H2,(H2,11,17)(H,12,13)/b15-14- | |
| dc.identifier.ichi | C8H12Cl2N6O,9-2H2-4H2-16(5H2-3H2-10)14-13-8-6(7(11H2)17)12-1H-15H-8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules