NSC135352
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-11T17:47:44Z | |
dc.date.available | 2006-01-11T17:47:44Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-11T17:47:44Z | |
dc.identifier | NSC135352 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/107076 | |
dc.format.extent | 3728 bytes | |
dc.format.extent | 4104 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC135352 | en_GB |
dc.title.alternative | 4-Azatricyclo[3.3.2.02,8]deca-3,6,9-triene, 3-methoxy- (8CI9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | GSTQZXLGKKJDDU-SPJNRGJMSA-N | |
dc.identifier.inchi | InChI=1S/C10H11NO/c1-12-10-9-7-4-2-6(11-10)3-5-8(7)9/h2-9H,1H3/t6-,7+,8-,9+ | |
dc.identifier.ichi | C10H11NO,1H3-12-6-10H-8H-4H-2H-7H(11-6)3H-5H-9H(8)10 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules