NSC136049
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-12T09:52:12Z | |
dc.date.available | 2006-01-12T09:52:12Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-12T09:52:12Z | |
dc.identifier | NSC136049 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/107531 | |
dc.format.extent | 5460 bytes | |
dc.format.extent | 5324 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC136049 | en_GB |
dc.title.alternative | Aromaticin | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | OSSDUQKWVVZIGP-SCGWIAOYSA-N | |
dc.identifier.inchi | InChI=1S/C15H18O3/c1-8-6-12-10(9(2)14(17)18-12)7-15(3)11(8)4-5-13(15)16/h4-5,8,10-12H,2,6-7H2,1,3H3/t8-,10-,11+,12+,15+/m1/s1 | |
dc.identifier.ichi | C15H18O3,1H2-8-10(17)18-14H-6H2-11H(2H3)12H-5H-4H-9(16)15(12,3H3)7H2-13H(8)14 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules