NSC136986
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-12T10:27:48Z | |
dc.date.available | 2006-01-12T10:27:48Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-12T10:27:48Z | |
dc.identifier | NSC136986 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/107981 | |
dc.format.extent | 10911 bytes | |
dc.format.extent | 8883 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC136986 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NJPMYUDKLUEWPT-BHIFYINESA-N | |
dc.identifier.inchi | InChI=1S/C26H35N5O7/c1-16(2)12-20(23(34)29-21(25(36)31-27)13-17-8-10-19(33)11-9-17)28-24(35)22(14-32)30-26(37)38-15-18-6-4-3-5-7-18/h3-11,16,20-22,32-33H,12-15,27H2,1-2H3,(H,28,35)(H,29,34)(H,30,37)(H,31,36)/t20-,21+,22-/m1/s1 | |
dc.identifier.ichi | C26H35N5O7,1H3-23H(2H3)14H2-25H(19(32)28H-24H(21(34)31H-27H2)12H2-16-8H-10H-18(37H)11H-9H-16)29H-20(33)26H(15H2-36H)30H-22(35)38-13H2-17-6H-4H-3H-5H-7H-17 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules