NSC141014
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2006-01-12T16:39:02Z | |
| dc.date.available | 2006-01-12T16:39:02Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2006-01-12T16:39:02Z | |
| dc.identifier | NSC141014 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/110407 | |
| dc.format.extent | 2282 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC141014 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | NZZGQYPYGTZUQH-UHFFFAOYSA-N | |
| dc.identifier.inchi | InChI=1S/C3H5N5/c1-2-8-3(4-1)5-6-7-8/h1-2H2,(H,4,5,7) | |
| dc.identifier.ichi | C3H5N5,1H2-2H2-8-3(4-1)7H-5-6-8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules