NSC145937
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-01-13T14:15:06Z | |
dc.date.available | 2006-01-13T14:15:06Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-01-13T14:15:06Z | |
dc.identifier | NSC145937 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/113260 | |
dc.format.extent | 8262 bytes | |
dc.format.extent | 7014 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC145937 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | USSAKKSOEROIGR-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C15H24N15P/c16-10-22-7(23-11(17)28-10)1-4-31(5-2-8-24-12(18)29-13(19)25-8)6-3-9-26-14(20)30-15(21)27-9/h1-6H2,(H4,16,17,22,23,28)(H4,18,19,24,25,29)(H4,20,21,26,27,30) | |
dc.identifier.ichi | C15H24N15P,16H2-10-22-7(23-11(17H2)28-10)1H2-4H2-31(5H2-2H2-8-24-12(18H2)29-13(19H2)25-8)6H2-3H2-9-26-14(20H2)30-15(21H2)27-9 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules