NSC243927
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-27T16:38:40Z | |
dc.date.available | 2006-04-27T16:38:40Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-27T16:38:40Z | |
dc.identifier | NSC243927 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/149626 | |
dc.format.extent | 5747 bytes | |
dc.format.extent | 5389 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC243927 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QKEKZPWPLPDBJJ-XBGNFKKLSA-N | |
dc.identifier.inchi | InChI=1S/C9H17N5O4S2/c10-8(19)12-2-4(13-14-9(11)20)1-5(16)7(18)6(17)3-15/h2,5-7,15-18H,1,3H2,(H2,10,19)(H3,11,14,20)/b12-2+,13-4+/t5-,6-,7-/m0/s1 | |
dc.identifier.ichi | C9H17N5O4S2,10H2-5(19)12-1H-4(13-14H-6(11H2)20)2H2-7H(16H)9H(18H)8H(17H)3H2-15H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules