NSC266071
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-04-28T15:35:05Z | |
dc.date.available | 2006-04-28T15:35:05Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-04-28T15:35:05Z | |
dc.identifier | NSC266071 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/154306 | |
dc.format.extent | 8688 bytes | |
dc.format.extent | 7627 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC266071 | en_GB |
dc.title.alternative | Hymenolane, from hymenoxys odorata DC | en_GB |
dc.title.alternative | HYMENOLANE | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | XUCKYCQJMPCOTH-BLRLGMQFSA-N | |
dc.identifier.inchi | InChI=1S/C21H30O8/c1-9-7-15-14(10(2)20(25)29-15)8-21(6)16(9)17(26-11(3)22)18(27-12(4)23)19(21)28-13(5)24/h9-10,14-19H,7-8H2,1-6H3/t9-,10+,14-,15+,16+,17-,18+,19-,21-/m1/s1 | |
dc.identifier.ichi | C21H30O8,1H3-9(22)26-18H-17H-13H(4H3)7H2-16H-15H(14H(5H3)12(25)29-16)8H2-21(17,6H3)20H(28-11(3H3)24)19H(18)27-10(2H3)23 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules