NSC269105
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T08:56:21Z | |
dc.date.available | 2006-05-02T08:56:21Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T08:56:21Z | |
dc.identifier | NSC269105 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/155245 | |
dc.format.extent | 13371 bytes | |
dc.format.extent | 10757 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC269105 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | QQSSCTZKIZFPMB-QXFLPFIJSA-N | |
dc.identifier.inchi | InChI=1S/C36H38O18/c1-7-36(47)11-19(53-35-33(52-16(5)40)32(51-15(4)39)31(50-14(3)38)20(54-35)12-49-13(2)37)22-23(26(36)34(46)48-6)30(45)24-25(29(22)44)28(43)21-17(27(24)42)9-8-10-18(21)41/h8-10,19-20,26,31-33,35,41,44-45,47H,7,11-12H2,1-6H3/t19-,20-,26-,31-,32+,33+,35-,36+/m0/s1 | |
dc.identifier.ichi | C36H38O18,1H3-10H2-36(47H)11H2-29H(53-35H-34H(52-16(5H3)40)33H(51-15(4H3)39)32H(50-14(3H3)38)30H(54-35)12H2-49-13(2H3)37)22-23(31H(36)28(43)48-6H3)27(46H)20-21(26(22)45H)25(42)19-17(24(20)41)8H-7H-9H-18(19)44H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules