NSC287497
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T14:28:24Z | |
dc.date.available | 2006-05-02T14:28:24Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T14:28:24Z | |
dc.identifier | NSC287497 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/159392 | |
dc.format.extent | 13259 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC287497 | en_GB |
dc.title.alternative | 6H-Pyrido[4,3-b]carbazolium, 2,2'-(1,8-octanediyl)bis[1, 5-dimethyl-, dibromide | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | FGPNISTTXYQQPU-UHFFFAOYSA-P | |
dc.identifier.inchi | InChI=1S/C42H42N4/c1-27-31-19-23-45(29(3)35(31)25-37-33-15-9-11-17-39(33)43-41(27)37)21-13-7-5-6-8-14-22-46-24-20-32-28(2)42-38(26-36(32)30(46)4)34-16-10-12-18-40(34)44-42/h9-12,15-20,23-26H,5-8,13-14,21-22H2,1-4H3/p+2 | |
dc.identifier.ichi | C42H44N4,1H3-27-31-13H-15H-45(29(3H3)35(31)17H-37-33-9H-5H-7H-11H-39(33)43H-41(27)37)25H2-23H2-21H2-19H2-20H2-22H2-24H2-26H2-46-16H-14H-32-28(2H3)42-38(18H-36(32)30(46)4H3)34-10H-6H-8H-12H-40(34)44H-42 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules